C13H19ClN4S — CID 82309309
N-(4-chlorothieno[2,3-d]pyrimidin-2-yl)-N',N'-diethylpropane-1,3-diamine (PubChem CID 82309309) has the molecular formula C13H19ClN4S and a molecular weight of 298.84 g/mol. Its IUPAC name is N-(4-chlorothieno[2,3-d]pyrimidin-2-yl)-N',N'-diethylpropane-1,3-diamine.
| Compound Name | N-(4-chlorothieno[2,3-d]pyrimidin-2-yl)-N',N'-diethylpropane-1,3-diamine |
|---|---|
| PubChem CID | 82309309 |
| Molecular Formula | C13H19ClN4S |
| Molecular Weight | 298.84 g/mol |
| Exact Mass | 298.10 |
| IUPAC Name | N-(4-chlorothieno[2,3-d]pyrimidin-2-yl)-N',N'-diethylpropane-1,3-diamine |
| SMILES | CCN(CC)CCCNc1nc(Cl)c2ccsc2n1 |
| InChI | InChI=1S/C13H19ClN4S/c1-3-18(4-2)8-5-7-15-13-16-11(14)10-6-9-19-12(10)17-13/h6,9H,3-5,7-8H2,1-2H3,(H,15,16,17) |
| InChIKey | JELJNGFXTYMLGA-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.84 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|