C11H13ClN2OS — CID 116701236
4-chloro-2-(2-ethoxypropan-2-yl)thieno[2,3-d]pyrimidine (PubChem CID 116701236) has the molecular formula C11H13ClN2OS and a molecular weight of 256.76 g/mol. Its IUPAC name is 4-chloro-2-(2-ethoxypropan-2-yl)thieno[2,3-d]pyrimidine.
| Compound Name | 4-chloro-2-(2-ethoxypropan-2-yl)thieno[2,3-d]pyrimidine |
|---|---|
| PubChem CID | 116701236 |
| Molecular Formula | C11H13ClN2OS |
| Molecular Weight | 256.76 g/mol |
| Exact Mass | 256.04 |
| IUPAC Name | 4-chloro-2-(2-ethoxypropan-2-yl)thieno[2,3-d]pyrimidine |
| SMILES | CCOC(C)(C)c1nc(Cl)c2ccsc2n1 |
| InChI | InChI=1S/C11H13ClN2OS/c1-4-15-11(2,3)10-13-8(12)7-5-6-16-9(7)14-10/h5-6H,4H2,1-3H3 |
| InChIKey | GHLMPDBWNGEAEY-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.76 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |