C15H13ClN2S — CID 63084498
4-chloro-2-(2-phenylpropan-2-yl)thieno[2,3-d]pyrimidine (PubChem CID 63084498) has the molecular formula C15H13ClN2S and a molecular weight of 288.80 g/mol. Its IUPAC name is 4-chloro-2-(2-phenylpropan-2-yl)thieno[2,3-d]pyrimidine.
| Compound Name | 4-chloro-2-(2-phenylpropan-2-yl)thieno[2,3-d]pyrimidine |
|---|---|
| PubChem CID | 63084498 |
| Molecular Formula | C15H13ClN2S |
| Molecular Weight | 288.80 g/mol |
| Exact Mass | 288.05 |
| IUPAC Name | 4-chloro-2-(2-phenylpropan-2-yl)thieno[2,3-d]pyrimidine |
| SMILES | CC(C)(c1ccccc1)c1nc(Cl)c2ccsc2n1 |
| InChI | InChI=1S/C15H13ClN2S/c1-15(2,10-6-4-3-5-7-10)14-17-12(16)11-8-9-19-13(11)18-14/h3-9H,1-2H3 |
| InChIKey | HGLCDLFRYASLMW-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.80 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |