C7H4BrClN2S — CID 119088627
2-(bromomethyl)-4-chlorothieno[2,3-d]pyrimidine (PubChem CID 119088627) has the molecular formula C7H4BrClN2S and a molecular weight of 263.55 g/mol. Its IUPAC name is 2-(bromomethyl)-4-chlorothieno[2,3-d]pyrimidine.
| Compound Name | 2-(bromomethyl)-4-chlorothieno[2,3-d]pyrimidine |
|---|---|
| PubChem CID | 119088627 |
| Molecular Formula | C7H4BrClN2S |
| Molecular Weight | 263.55 g/mol |
| Exact Mass | 261.90 |
| IUPAC Name | 2-(bromomethyl)-4-chlorothieno[2,3-d]pyrimidine |
| SMILES | Clc1nc(CBr)nc2sccc12 |
| InChI | InChI=1S/C7H4BrClN2S/c8-3-5-10-6(9)4-1-2-12-7(4)11-5/h1-2H,3H2 |
| InChIKey | NOLDFGILVPHIBB-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.55 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|