C15H21ClN2OS — CID 62188659
4-chloro-2-(octoxymethyl)thieno[2,3-d]pyrimidine (PubChem CID 62188659) has the molecular formula C15H21ClN2OS and a molecular weight of 312.87 g/mol. Its IUPAC name is 4-chloro-2-(octoxymethyl)thieno[2,3-d]pyrimidine.
| Compound Name | 4-chloro-2-(octoxymethyl)thieno[2,3-d]pyrimidine |
|---|---|
| PubChem CID | 62188659 |
| Molecular Formula | C15H21ClN2OS |
| Molecular Weight | 312.87 g/mol |
| Exact Mass | 312.11 |
| IUPAC Name | 4-chloro-2-(octoxymethyl)thieno[2,3-d]pyrimidine |
| SMILES | CCCCCCCCOCc1nc(Cl)c2ccsc2n1 |
| InChI | InChI=1S/C15H21ClN2OS/c1-2-3-4-5-6-7-9-19-11-13-17-14(16)12-8-10-20-15(12)18-13/h8,10H,2-7,9,11H2,1H3 |
| InChIKey | YULYCGFRYUMEPD-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.87 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|