C14H19ClN2OS — CID 43275113
4-chloro-5,6-dimethyl-2-(pentoxymethyl)thieno[2,3-d]pyrimidine (PubChem CID 43275113) has the molecular formula C14H19ClN2OS and a molecular weight of 298.84 g/mol. Its IUPAC name is 4-chloro-5,6-dimethyl-2-(pentoxymethyl)thieno[2,3-d]pyrimidine.
| Compound Name | 4-chloro-5,6-dimethyl-2-(pentoxymethyl)thieno[2,3-d]pyrimidine |
|---|---|
| PubChem CID | 43275113 |
| Molecular Formula | C14H19ClN2OS |
| Molecular Weight | 298.84 g/mol |
| Exact Mass | 298.09 |
| IUPAC Name | 4-chloro-5,6-dimethyl-2-(pentoxymethyl)thieno[2,3-d]pyrimidine |
| SMILES | CCCCCOCc1nc(Cl)c2c(C)c(C)sc2n1 |
| InChI | InChI=1S/C14H19ClN2OS/c1-4-5-6-7-18-8-11-16-13(15)12-9(2)10(3)19-14(12)17-11/h4-8H2,1-3H3 |
| InChIKey | PHZCUVBOTQDFCB-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.84 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|