C12H17ClN4O — CID 63220809
4-chloro-1-methyl-6-(pentoxymethyl)pyrazolo[5,4-d]pyrimidine (PubChem CID 63220809) has the molecular formula C12H17ClN4O and a molecular weight of 268.75 g/mol. Its IUPAC name is 4-chloro-1-methyl-6-(pentoxymethyl)pyrazolo[5,4-d]pyrimidine.
| Compound Name | 4-chloro-1-methyl-6-(pentoxymethyl)pyrazolo[5,4-d]pyrimidine |
|---|---|
| PubChem CID | 63220809 |
| Molecular Formula | C12H17ClN4O |
| Molecular Weight | 268.75 g/mol |
| Exact Mass | 268.11 |
| IUPAC Name | 4-chloro-1-methyl-6-(pentoxymethyl)pyrazolo[5,4-d]pyrimidine |
| SMILES | CCCCCOCc1nc(Cl)c2cnn(C)c2n1 |
| InChI | InChI=1S/C12H17ClN4O/c1-3-4-5-6-18-8-10-15-11(13)9-7-14-17(2)12(9)16-10/h7H,3-6,8H2,1-2H3 |
| InChIKey | CSQQRCITWCVDGB-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 52.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.75 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|