C13H10ClIN4O — CID 63221164
4-chloro-6-[(4-iodophenoxy)methyl]-1-methylpyrazolo[5,4-d]pyrimidine (PubChem CID 63221164) has the molecular formula C13H10ClIN4O and a molecular weight of 400.61 g/mol. Its IUPAC name is 4-chloro-6-[(4-iodophenoxy)methyl]-1-methylpyrazolo[5,4-d]pyrimidine.
| Compound Name | 4-chloro-6-[(4-iodophenoxy)methyl]-1-methylpyrazolo[5,4-d]pyrimidine |
|---|---|
| PubChem CID | 63221164 |
| Molecular Formula | C13H10ClIN4O |
| Molecular Weight | 400.61 g/mol |
| Exact Mass | 399.96 |
| IUPAC Name | 4-chloro-6-[(4-iodophenoxy)methyl]-1-methylpyrazolo[5,4-d]pyrimidine |
| SMILES | Cn1ncc2c(Cl)nc(COc3ccc(I)cc3)nc21 |
| InChI | InChI=1S/C13H10ClIN4O/c1-19-13-10(6-16-19)12(14)17-11(18-13)7-20-9-4-2-8(15)3-5-9/h2-6H,7H2,1H3 |
| InChIKey | VRQVRMPQJIHXIE-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 52.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.61 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|