C13H13N5O — CID 63221328
1-methyl-6-(phenoxymethyl)pyrazolo[3,4-d]pyrimidin-4-amine (PubChem CID 63221328) has the molecular formula C13H13N5O and a molecular weight of 255.28 g/mol. Its IUPAC name is 1-methyl-6-(phenoxymethyl)pyrazolo[3,4-d]pyrimidin-4-amine.
| Compound Name | 1-methyl-6-(phenoxymethyl)pyrazolo[3,4-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 63221328 |
| Molecular Formula | C13H13N5O |
| Molecular Weight | 255.28 g/mol |
| Exact Mass | 255.11 |
| IUPAC Name | 1-methyl-6-(phenoxymethyl)pyrazolo[3,4-d]pyrimidin-4-amine |
| SMILES | Cn1ncc2c(N)nc(COc3ccccc3)nc21 |
| InChI | InChI=1S/C13H13N5O/c1-18-13-10(7-15-18)12(14)16-11(17-13)8-19-9-5-3-2-4-6-9/h2-7H,8H2,1H3,(H2,14,16,17) |
| InChIKey | LCKUSFHAWBQTLB-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 78.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.28 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |