C10H15N5O2 — CID 63220831
6-(2-methoxyethoxymethyl)-1-methylpyrazolo[3,4-d]pyrimidin-4-amine (PubChem CID 63220831) has the molecular formula C10H15N5O2 and a molecular weight of 237.26 g/mol. Its IUPAC name is 6-(2-methoxyethoxymethyl)-1-methylpyrazolo[3,4-d]pyrimidin-4-amine.
| Compound Name | 6-(2-methoxyethoxymethyl)-1-methylpyrazolo[3,4-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 63220831 |
| Molecular Formula | C10H15N5O2 |
| Molecular Weight | 237.26 g/mol |
| Exact Mass | 237.12 |
| IUPAC Name | 6-(2-methoxyethoxymethyl)-1-methylpyrazolo[3,4-d]pyrimidin-4-amine |
| SMILES | COCCOCc1nc(N)c2cnn(C)c2n1 |
| InChI | InChI=1S/C10H15N5O2/c1-15-10-7(5-12-15)9(11)13-8(14-10)6-17-4-3-16-2/h5H,3-4,6H2,1-2H3,(H2,11,13,14) |
| InChIKey | LMDSRRKYIVQKEW-UHFFFAOYSA-N |
| XLogP | 0.11 |
| TPSA | 88.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.26 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|