C13H19N3OS — CID 62194153
N-methyl-2-(pentoxymethyl)thieno[2,3-d]pyrimidin-4-amine (PubChem CID 62194153) has the molecular formula C13H19N3OS and a molecular weight of 265.38 g/mol. Its IUPAC name is N-methyl-2-(pentoxymethyl)thieno[2,3-d]pyrimidin-4-amine.
| Compound Name | N-methyl-2-(pentoxymethyl)thieno[2,3-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 62194153 |
| Molecular Formula | C13H19N3OS |
| Molecular Weight | 265.38 g/mol |
| Exact Mass | 265.12 |
| IUPAC Name | N-methyl-2-(pentoxymethyl)thieno[2,3-d]pyrimidin-4-amine |
| SMILES | CCCCCOCc1nc(NC)c2ccsc2n1 |
| InChI | InChI=1S/C13H19N3OS/c1-3-4-5-7-17-9-11-15-12(14-2)10-6-8-18-13(10)16-11/h6,8H,3-5,7,9H2,1-2H3,(H,14,15,16) |
| InChIKey | PDJYWKXAJVAQQX-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.38 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|