C11H12F3N3OS — CID 82956781
N-methyl-2-(3,3,3-trifluoropropoxymethyl)thieno[2,3-d]pyrimidin-4-amine (PubChem CID 82956781) has the molecular formula C11H12F3N3OS and a molecular weight of 291.30 g/mol. Its IUPAC name is N-methyl-2-(3,3,3-trifluoropropoxymethyl)thieno[2,3-d]pyrimidin-4-amine.
| Compound Name | N-methyl-2-(3,3,3-trifluoropropoxymethyl)thieno[2,3-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 82956781 |
| Molecular Formula | C11H12F3N3OS |
| Molecular Weight | 291.30 g/mol |
| Exact Mass | 291.07 |
| IUPAC Name | N-methyl-2-(3,3,3-trifluoropropoxymethyl)thieno[2,3-d]pyrimidin-4-amine |
| SMILES | CNc1nc(COCCC(F)(F)F)nc2sccc12 |
| InChI | InChI=1S/C11H12F3N3OS/c1-15-9-7-2-5-19-10(7)17-8(16-9)6-18-4-3-11(12,13)14/h2,5H,3-4,6H2,1H3,(H,15,16,17) |
| InChIKey | FGEZDDMLTQCQAE-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.30 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|