C14H19N3O2S — CID 62195337
N-methyl-2-(oxan-2-ylmethoxymethyl)thieno[2,3-d]pyrimidin-4-amine (PubChem CID 62195337) has the molecular formula C14H19N3O2S and a molecular weight of 293.39 g/mol. Its IUPAC name is N-methyl-2-(oxan-2-ylmethoxymethyl)thieno[2,3-d]pyrimidin-4-amine.
| Compound Name | N-methyl-2-(oxan-2-ylmethoxymethyl)thieno[2,3-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 62195337 |
| Molecular Formula | C14H19N3O2S |
| Molecular Weight | 293.39 g/mol |
| Exact Mass | 293.12 |
| IUPAC Name | N-methyl-2-(oxan-2-ylmethoxymethyl)thieno[2,3-d]pyrimidin-4-amine |
| SMILES | CNc1nc(COCC2CCCCO2)nc2sccc12 |
| InChI | InChI=1S/C14H19N3O2S/c1-15-13-11-5-7-20-14(11)17-12(16-13)9-18-8-10-4-2-3-6-19-10/h5,7,10H,2-4,6,8-9H2,1H3,(H,15,16,17) |
| InChIKey | QIGJKXZSHCVMGB-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 56.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.39 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |