C17H22Cl3N5S — CID 118250682
N',N'-diethyl-N-[4-(4-methylsulfanylphenyl)-6-(trichloromethyl)-1,3,5-triazin-2-yl]ethane-1,2-diamine (PubChem CID 118250682) has the molecular formula C17H22Cl3N5S and a molecular weight of 434.82 g/mol. Its IUPAC name is N',N'-diethyl-N-[4-(4-methylsulfanylphenyl)-6-(trichloromethyl)-1,3,5-triazin-2-yl]ethane-1,2-diamine.
| Compound Name | N',N'-diethyl-N-[4-(4-methylsulfanylphenyl)-6-(trichloromethyl)-1,3,5-triazin-2-yl]ethane-1,2-diamine |
|---|---|
| PubChem CID | 118250682 |
| Molecular Formula | C17H22Cl3N5S |
| Molecular Weight | 434.82 g/mol |
| Exact Mass | 433.07 |
| IUPAC Name | N',N'-diethyl-N-[4-(4-methylsulfanylphenyl)-6-(trichloromethyl)-1,3,5-triazin-2-yl]ethane-1,2-diamine |
| SMILES | CCN(CC)CCNc1nc(-c2ccc(SC)cc2)nc(C(Cl)(Cl)Cl)n1 |
| InChI | InChI=1S/C17H22Cl3N5S/c1-4-25(5-2)11-10-21-16-23-14(22-15(24-16)17(18,19)20)12-6-8-13(26-3)9-7-12/h6-9H,4-5,10-11H2,1-3H3,(H,21,22,23,24) |
| InChIKey | JFCXSCBIYTYEGF-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 53.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.82 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|