C18H16Cl3N5O2S — CID 118250453
4-(4-methylsulfonylphenyl)-N-(2-pyridin-4-ylethyl)-6-(trichloromethyl)-1,3,5-triazin-2-amine (PubChem CID 118250453) has the molecular formula C18H16Cl3N5O2S and a molecular weight of 472.79 g/mol. Its IUPAC name is 4-(4-methylsulfonylphenyl)-N-(2-pyridin-4-ylethyl)-6-(trichloromethyl)-1,3,5-triazin-2-amine.
| Compound Name | 4-(4-methylsulfonylphenyl)-N-(2-pyridin-4-ylethyl)-6-(trichloromethyl)-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 118250453 |
| Molecular Formula | C18H16Cl3N5O2S |
| Molecular Weight | 472.79 g/mol |
| Exact Mass | 471.01 |
| IUPAC Name | 4-(4-methylsulfonylphenyl)-N-(2-pyridin-4-ylethyl)-6-(trichloromethyl)-1,3,5-triazin-2-amine |
| SMILES | CS(=O)(=O)c1ccc(-c2nc(NCCc3ccncc3)nc(C(Cl)(Cl)Cl)n2)cc1 |
| InChI | InChI=1S/C18H16Cl3N5O2S/c1-29(27,28)14-4-2-13(3-5-14)15-24-16(18(19,20)21)26-17(25-15)23-11-8-12-6-9-22-10-7-12/h2-7,9-10H,8,11H2,1H3,(H,23,24,25,26) |
| InChIKey | YZJWOEYTCPDSEB-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 97.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.79 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|