C15H19N3O2S — CID 60721671
N,N-dimethyl-4-(2-pyridin-4-ylethylamino)benzenesulfonamide (PubChem CID 60721671) has the molecular formula C15H19N3O2S and a molecular weight of 305.40 g/mol. Its IUPAC name is N,N-dimethyl-4-(2-pyridin-4-ylethylamino)benzenesulfonamide.
| Compound Name | N,N-dimethyl-4-(2-pyridin-4-ylethylamino)benzenesulfonamide |
|---|---|
| PubChem CID | 60721671 |
| Molecular Formula | C15H19N3O2S |
| Molecular Weight | 305.40 g/mol |
| Exact Mass | 305.12 |
| IUPAC Name | N,N-dimethyl-4-(2-pyridin-4-ylethylamino)benzenesulfonamide |
| SMILES | CN(C)S(=O)(=O)c1ccc(NCCc2ccncc2)cc1 |
| InChI | InChI=1S/C15H19N3O2S/c1-18(2)21(19,20)15-5-3-14(4-6-15)17-12-9-13-7-10-16-11-8-13/h3-8,10-11,17H,9,12H2,1-2H3 |
| InChIKey | GJGBVGGGBOQZDB-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.40 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |