C13H23N3O2S — CID 54906965
4-[3-(ethylamino)propylamino]-N,N-dimethylbenzenesulfonamide (PubChem CID 54906965) has the molecular formula C13H23N3O2S and a molecular weight of 285.41 g/mol. Its IUPAC name is 4-[3-(ethylamino)propylamino]-N,N-dimethylbenzenesulfonamide.
| Compound Name | 4-[3-(ethylamino)propylamino]-N,N-dimethylbenzenesulfonamide |
|---|---|
| PubChem CID | 54906965 |
| Molecular Formula | C13H23N3O2S |
| Molecular Weight | 285.41 g/mol |
| Exact Mass | 285.15 |
| IUPAC Name | 4-[3-(ethylamino)propylamino]-N,N-dimethylbenzenesulfonamide |
| SMILES | CCNCCCNc1ccc(S(=O)(=O)N(C)C)cc1 |
| InChI | InChI=1S/C13H23N3O2S/c1-4-14-10-5-11-15-12-6-8-13(9-7-12)19(17,18)16(2)3/h6-9,14-15H,4-5,10-11H2,1-3H3 |
| InChIKey | UIQQSEYRTNXLRM-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.41 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|