C12H7Cl6N3O3S — CID 58719245
methyl 4-[4,6-bis(trichloromethyl)-1,3,5-triazin-2-yl]benzenesulfonate (PubChem CID 58719245) has the molecular formula C12H7Cl6N3O3S and a molecular weight of 485.99 g/mol. Its IUPAC name is methyl 4-[4,6-bis(trichloromethyl)-1,3,5-triazin-2-yl]benzenesulfonate.
| Compound Name | methyl 4-[4,6-bis(trichloromethyl)-1,3,5-triazin-2-yl]benzenesulfonate |
|---|---|
| PubChem CID | 58719245 |
| Molecular Formula | C12H7Cl6N3O3S |
| Molecular Weight | 485.99 g/mol |
| Exact Mass | 482.83 |
| IUPAC Name | methyl 4-[4,6-bis(trichloromethyl)-1,3,5-triazin-2-yl]benzenesulfonate |
| SMILES | COS(=O)(=O)c1ccc(-c2nc(C(Cl)(Cl)Cl)nc(C(Cl)(Cl)Cl)n2)cc1 |
| InChI | InChI=1S/C12H7Cl6N3O3S/c1-24-25(22,23)7-4-2-6(3-5-7)8-19-9(11(13,14)15)21-10(20-8)12(16,17)18/h2-5H,1H3 |
| InChIKey | QSDGIFSPNRORGF-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 82.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.99 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|