C19H18Cl6N4O4 — CID 59592160
4-[4,6-bis(trichloromethyl)-1,3,5-triazin-2-yl]-N,N-bis(1-ethylperoxyethenyl)aniline (PubChem CID 59592160) has the molecular formula C19H18Cl6N4O4 and a molecular weight of 579.10 g/mol. Its IUPAC name is 4-[4,6-bis(trichloromethyl)-1,3,5-triazin-2-yl]-N,N-bis(1-ethylperoxyethenyl)aniline.
| Compound Name | 4-[4,6-bis(trichloromethyl)-1,3,5-triazin-2-yl]-N,N-bis(1-ethylperoxyethenyl)aniline |
|---|---|
| PubChem CID | 59592160 |
| Molecular Formula | C19H18Cl6N4O4 |
| Molecular Weight | 579.10 g/mol |
| Exact Mass | 575.95 |
| IUPAC Name | 4-[4,6-bis(trichloromethyl)-1,3,5-triazin-2-yl]-N,N-bis(1-ethylperoxyethenyl)aniline |
| SMILES | C=C(OOCC)N(C(=C)OOCC)c1ccc(-c2nc(C(Cl)(Cl)Cl)nc(C(Cl)(Cl)Cl)n2)cc1 |
| InChI | InChI=1S/C19H18Cl6N4O4/c1-5-30-32-11(3)29(12(4)33-31-6-2)14-9-7-13(8-10-14)15-26-16(18(20,21)22)28-17(27-15)19(23,24)25/h7-10H,3-6H2,1-2H3 |
| InChIKey | UQCKKKYLQUYKRU-UHFFFAOYSA-N |
| XLogP | 6.88 |
| TPSA | 78.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.10 |
| LogP ≤ 5 | 6.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|