C32H29Cl6N6O2+ — CID 59986158
3-[3,6-bis(dimethylamino)acridin-10-ium-10-yl]propyl 4-[4,6-bis(trichloromethyl)-1,3,5-triazin-2-yl]benzoate (PubChem CID 59986158) has the molecular formula C32H29Cl6N6O2+ and a molecular weight of 742.34 g/mol. Its IUPAC name is 3-[3,6-bis(dimethylamino)acridin-10-ium-10-yl]propyl 4-[4,6-bis(trichloromethyl)-1,3,5-triazin-2-yl]benzoate.
| Compound Name | 3-[3,6-bis(dimethylamino)acridin-10-ium-10-yl]propyl 4-[4,6-bis(trichloromethyl)-1,3,5-triazin-2-yl]benzoate |
|---|---|
| PubChem CID | 59986158 |
| Molecular Formula | C32H29Cl6N6O2+ |
| Molecular Weight | 742.34 g/mol |
| Exact Mass | 739.05 |
| IUPAC Name | 3-[3,6-bis(dimethylamino)acridin-10-ium-10-yl]propyl 4-[4,6-bis(trichloromethyl)-1,3,5-triazin-2-yl]benzoate |
| SMILES | CN(C)c1ccc2cc3ccc(N(C)C)cc3[n+](CCCOC(=O)c3ccc(-c4nc(C(Cl)(Cl)Cl)nc(C(Cl)(Cl)Cl)n4)cc3)c2c1 |
| InChI | InChI=1S/C32H29Cl6N6O2/c1-42(2)23-12-10-21-16-22-11-13-24(43(3)4)18-26(22)44(25(21)17-23)14-5-15-46-28(45)20-8-6-19(7-9-20)27-39-29(31(33,34)35)41-30(40-27)32(36,37)38/h6-13,16-18H,5,14-15H2,1-4H3/q+1 |
| InChIKey | QTHXVGXVBVQTEN-UHFFFAOYSA-N |
| XLogP | 8.16 |
| TPSA | 75.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 742.34 |
| LogP ≤ 5 | 8.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|