C30H45N4O3+ — CID 161468885
6-[6-[3,6-bis(dimethylamino)acridin-10-ium-10-yl]hexanoylamino]hexanoic acid;methane (PubChem CID 161468885) has the molecular formula C30H45N4O3+ and a molecular weight of 509.72 g/mol. Its IUPAC name is 6-[6-[3,6-bis(dimethylamino)acridin-10-ium-10-yl]hexanoylamino]hexanoic acid;methane.
| Compound Name | 6-[6-[3,6-bis(dimethylamino)acridin-10-ium-10-yl]hexanoylamino]hexanoic acid;methane |
|---|---|
| PubChem CID | 161468885 |
| Molecular Formula | C30H45N4O3+ |
| Molecular Weight | 509.72 g/mol |
| Exact Mass | 509.35 |
| IUPAC Name | 6-[6-[3,6-bis(dimethylamino)acridin-10-ium-10-yl]hexanoylamino]hexanoic acid;methane |
| SMILES | C.CN(C)c1ccc2cc3ccc(N(C)C)cc3[n+](CCCCCC(=O)NCCCCCC(=O)O)c2c1 |
| InChI | InChI=1S/C29H40N4O3.CH4/c1-31(2)24-15-13-22-19-23-14-16-25(32(3)4)21-27(23)33(26(22)20-24)18-10-6-7-11-28(34)30-17-9-5-8-12-29(35)36;/h13-16,19-21H,5-12,17-18H2,1-4H3,(H-,30,34,35,36);1H4/p+1 |
| InChIKey | UEAXZVSEBMVSSA-UHFFFAOYSA-O |
| XLogP | 5.37 |
| TPSA | 76.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.72 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|