C33H50N5O3+ — CID 87093763
butyl N-[5-[6-[3,6-bis(dimethylamino)acridin-10-ium-10-yl]hexanoylamino]pentyl]carbamate (PubChem CID 87093763) has the molecular formula C33H50N5O3+ and a molecular weight of 564.80 g/mol. Its IUPAC name is butyl N-[5-[6-[3,6-bis(dimethylamino)acridin-10-ium-10-yl]hexanoylamino]pentyl]carbamate.
| Compound Name | butyl N-[5-[6-[3,6-bis(dimethylamino)acridin-10-ium-10-yl]hexanoylamino]pentyl]carbamate |
|---|---|
| PubChem CID | 87093763 |
| Molecular Formula | C33H50N5O3+ |
| Molecular Weight | 564.80 g/mol |
| Exact Mass | 564.39 |
| IUPAC Name | butyl N-[5-[6-[3,6-bis(dimethylamino)acridin-10-ium-10-yl]hexanoylamino]pentyl]carbamate |
| SMILES | CCCCOC(=O)NCCCCCNC(=O)CCCCC[n+]1c2cc(N(C)C)ccc2cc2ccc(N(C)C)cc21 |
| InChI | InChI=1S/C33H49N5O3/c1-6-7-22-41-33(40)35-20-12-9-11-19-34-32(39)14-10-8-13-21-38-30-24-28(36(2)3)17-15-26(30)23-27-16-18-29(37(4)5)25-31(27)38/h15-18,23-25H,6-14,19-22H2,1-5H3,(H-,34,35,39,40)/p+1 |
| InChIKey | BFNHQGIDLZEMPF-UHFFFAOYSA-O |
| XLogP | 5.79 |
| TPSA | 77.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.80 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|