C31H45ClN8O — CID 71475399
2-[1-[2-(2-aminoethylamino)ethyl]-3,5-dimethylpyrazol-4-yl]-N-[3-[3,6-bis(dimethylamino)acridin-10-ium-10-yl]propyl]acetamide chloride (PubChem CID 71475399) has the molecular formula C31H45ClN8O and a molecular weight of 581.21 g/mol. Its IUPAC name is 2-[1-[2-(2-aminoethylamino)ethyl]-3,5-dimethylpyrazol-4-yl]-N-[3-[3,6-bis(dimethylamino)acridin-10-ium-10-yl]propyl]acetamide chloride.
| Compound Name | 2-[1-[2-(2-aminoethylamino)ethyl]-3,5-dimethylpyrazol-4-yl]-N-[3-[3,6-bis(dimethylamino)acridin-10-ium-10-yl]propyl]acetamide chloride |
|---|---|
| PubChem CID | 71475399 |
| Molecular Formula | C31H45ClN8O |
| Molecular Weight | 581.21 g/mol |
| Exact Mass | 580.34 |
| IUPAC Name | 2-[1-[2-(2-aminoethylamino)ethyl]-3,5-dimethylpyrazol-4-yl]-N-[3-[3,6-bis(dimethylamino)acridin-10-ium-10-yl]propyl]acetamide chloride |
| SMILES | Cc1nn(CCNCCN)c(C)c1CC(=O)NCCC[n+]1c2cc(N(C)C)ccc2cc2ccc(N(C)C)cc21.[Cl-] |
| InChI | InChI=1S/C31H44N8O.ClH/c1-22-28(23(2)39(35-22)17-15-33-14-12-32)21-31(40)34-13-7-16-38-29-19-26(36(3)4)10-8-24(29)18-25-9-11-27(37(5)6)20-30(25)38;/h8-11,18-20,33H,7,12-17,21,32H2,1-6H3;1H |
| InChIKey | KRETXALAPOUAQI-UHFFFAOYSA-N |
| XLogP | -0.47 |
| TPSA | 95.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.21 |
| LogP ≤ 5 | -0.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|