C18H24ClFN4O2 — CID 58157024
N-[(2-chloro-4-fluorophenyl)methyl]-2-[1-[2-(2-hydroxyethylamino)ethyl]-3,5-dimethylpyrazol-4-yl]acetamide (PubChem CID 58157024) has the molecular formula C18H24ClFN4O2 and a molecular weight of 382.87 g/mol. Its IUPAC name is N-[(2-chloro-4-fluorophenyl)methyl]-2-[1-[2-(2-hydroxyethylamino)ethyl]-3,5-dimethylpyrazol-4-yl]acetamide.
| Compound Name | N-[(2-chloro-4-fluorophenyl)methyl]-2-[1-[2-(2-hydroxyethylamino)ethyl]-3,5-dimethylpyrazol-4-yl]acetamide |
|---|---|
| PubChem CID | 58157024 |
| Molecular Formula | C18H24ClFN4O2 |
| Molecular Weight | 382.87 g/mol |
| Exact Mass | 382.16 |
| IUPAC Name | N-[(2-chloro-4-fluorophenyl)methyl]-2-[1-[2-(2-hydroxyethylamino)ethyl]-3,5-dimethylpyrazol-4-yl]acetamide |
| SMILES | Cc1nn(CCNCCO)c(C)c1CC(=O)NCc1ccc(F)cc1Cl |
| InChI | InChI=1S/C18H24ClFN4O2/c1-12-16(13(2)24(23-12)7-5-21-6-8-25)10-18(26)22-11-14-3-4-15(20)9-17(14)19/h3-4,9,21,25H,5-8,10-11H2,1-2H3,(H,22,26) |
| InChIKey | ZQKMJKNFIFYWIM-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 79.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.87 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|