C17H18ClF4N3O4S — CID 86651288
2-[4-[2-[(2-chloro-4-fluorophenyl)methylamino]-2-oxoethyl]-3,5-dimethylpyrazol-1-yl]ethyl trifluoromethanesulfonate (PubChem CID 86651288) has the molecular formula C17H18ClF4N3O4S and a molecular weight of 471.86 g/mol. Its IUPAC name is 2-[4-[2-[(2-chloro-4-fluorophenyl)methylamino]-2-oxoethyl]-3,5-dimethylpyrazol-1-yl]ethyl trifluoromethanesulfonate.
| Compound Name | 2-[4-[2-[(2-chloro-4-fluorophenyl)methylamino]-2-oxoethyl]-3,5-dimethylpyrazol-1-yl]ethyl trifluoromethanesulfonate |
|---|---|
| PubChem CID | 86651288 |
| Molecular Formula | C17H18ClF4N3O4S |
| Molecular Weight | 471.86 g/mol |
| Exact Mass | 471.06 |
| IUPAC Name | 2-[4-[2-[(2-chloro-4-fluorophenyl)methylamino]-2-oxoethyl]-3,5-dimethylpyrazol-1-yl]ethyl trifluoromethanesulfonate |
| SMILES | Cc1nn(CCOS(=O)(=O)C(F)(F)F)c(C)c1CC(=O)NCc1ccc(F)cc1Cl |
| InChI | InChI=1S/C17H18ClF4N3O4S/c1-10-14(8-16(26)23-9-12-3-4-13(19)7-15(12)18)11(2)25(24-10)5-6-29-30(27,28)17(20,21)22/h3-4,7H,5-6,8-9H2,1-2H3,(H,23,26) |
| InChIKey | GTPZSIZFBAQOPP-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 90.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.86 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|