C21H32N4O — CID 134061320
2-[3,5-dimethyl-1-(2-methylpropyl)pyrazol-4-yl]-N-[3-(N-methylanilino)propyl]acetamide (PubChem CID 134061320) has the molecular formula C21H32N4O and a molecular weight of 356.51 g/mol. Its IUPAC name is 2-[3,5-dimethyl-1-(2-methylpropyl)pyrazol-4-yl]-N-[3-(N-methylanilino)propyl]acetamide.
| Compound Name | 2-[3,5-dimethyl-1-(2-methylpropyl)pyrazol-4-yl]-N-[3-(N-methylanilino)propyl]acetamide |
|---|---|
| PubChem CID | 134061320 |
| Molecular Formula | C21H32N4O |
| Molecular Weight | 356.51 g/mol |
| Exact Mass | 356.26 |
| IUPAC Name | 2-[3,5-dimethyl-1-(2-methylpropyl)pyrazol-4-yl]-N-[3-(N-methylanilino)propyl]acetamide |
| SMILES | Cc1nn(CC(C)C)c(C)c1CC(=O)NCCCN(C)c1ccccc1 |
| InChI | InChI=1S/C21H32N4O/c1-16(2)15-25-18(4)20(17(3)23-25)14-21(26)22-12-9-13-24(5)19-10-7-6-8-11-19/h6-8,10-11,16H,9,12-15H2,1-5H3,(H,22,26) |
| InChIKey | IRDFJOROXLCXQN-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.51 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|