C20H29N3O2 — CID 38449351
2-[3,5-dimethyl-1-(2-methylpropyl)pyrazol-4-yl]-N-[2-(4-methylphenoxy)ethyl]acetamide (PubChem CID 38449351) has the molecular formula C20H29N3O2 and a molecular weight of 343.47 g/mol. Its IUPAC name is 2-[3,5-dimethyl-1-(2-methylpropyl)pyrazol-4-yl]-N-[2-(4-methylphenoxy)ethyl]acetamide.
| Compound Name | 2-[3,5-dimethyl-1-(2-methylpropyl)pyrazol-4-yl]-N-[2-(4-methylphenoxy)ethyl]acetamide |
|---|---|
| PubChem CID | 38449351 |
| Molecular Formula | C20H29N3O2 |
| Molecular Weight | 343.47 g/mol |
| Exact Mass | 343.23 |
| IUPAC Name | 2-[3,5-dimethyl-1-(2-methylpropyl)pyrazol-4-yl]-N-[2-(4-methylphenoxy)ethyl]acetamide |
| SMILES | Cc1ccc(OCCNC(=O)Cc2c(C)nn(CC(C)C)c2C)cc1 |
| InChI | InChI=1S/C20H29N3O2/c1-14(2)13-23-17(5)19(16(4)22-23)12-20(24)21-10-11-25-18-8-6-15(3)7-9-18/h6-9,14H,10-13H2,1-5H3,(H,21,24) |
| InChIKey | VHNADTIPBSQCGG-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.47 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|