C26H32N5O2+ — CID 53310862
methyl 3-[4-[3,6-bis(dimethylamino)acridin-10-ium-10-yl]butyl]imidazole-4-carboxylate (PubChem CID 53310862) has the molecular formula C26H32N5O2+ and a molecular weight of 446.58 g/mol. Its IUPAC name is methyl 3-[4-[3,6-bis(dimethylamino)acridin-10-ium-10-yl]butyl]imidazole-4-carboxylate.
| Compound Name | methyl 3-[4-[3,6-bis(dimethylamino)acridin-10-ium-10-yl]butyl]imidazole-4-carboxylate |
|---|---|
| PubChem CID | 53310862 |
| Molecular Formula | C26H32N5O2+ |
| Molecular Weight | 446.58 g/mol |
| Exact Mass | 446.26 |
| IUPAC Name | methyl 3-[4-[3,6-bis(dimethylamino)acridin-10-ium-10-yl]butyl]imidazole-4-carboxylate |
| SMILES | COC(=O)c1cncn1CCCC[n+]1c2cc(N(C)C)ccc2cc2ccc(N(C)C)cc21 |
| InChI | InChI=1S/C26H32N5O2/c1-28(2)21-10-8-19-14-20-9-11-22(29(3)4)16-24(20)31(23(19)15-21)13-7-6-12-30-18-27-17-25(30)26(32)33-5/h8-11,14-18H,6-7,12-13H2,1-5H3/q+1 |
| InChIKey | OBQVUGQGDSPVNT-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 54.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.58 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|