C15H11N3O2 — CID 14067504
ethyl 4-cyanoimidazo[1,2-a]quinoline-2-carboxylate (PubChem CID 14067504) has the molecular formula C15H11N3O2 and a molecular weight of 265.27 g/mol. Its IUPAC name is ethyl 4-cyanoimidazo[1,2-a]quinoline-2-carboxylate.
| Compound Name | ethyl 4-cyanoimidazo[1,2-a]quinoline-2-carboxylate |
|---|---|
| PubChem CID | 14067504 |
| Molecular Formula | C15H11N3O2 |
| Molecular Weight | 265.27 g/mol |
| Exact Mass | 265.09 |
| IUPAC Name | ethyl 4-cyanoimidazo[1,2-a]quinoline-2-carboxylate |
| SMILES | CCOC(=O)c1cn2c(n1)c(C#N)cc1ccccc12 |
| InChI | InChI=1S/C15H11N3O2/c1-2-20-15(19)12-9-18-13-6-4-3-5-10(13)7-11(8-16)14(18)17-12/h3-7,9H,2H2,1H3 |
| InChIKey | LTNHTSCFIRHPSI-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 67.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.27 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |