C29H31N4O2+ — CID 46918482
2-[4-[3,6-bis(dimethylamino)acridin-10-ium-10-yl]butyl]isoindole-1,3-dione (PubChem CID 46918482) has the molecular formula C29H31N4O2+ and a molecular weight of 467.59 g/mol. Its IUPAC name is 2-[4-[3,6-bis(dimethylamino)acridin-10-ium-10-yl]butyl]isoindole-1,3-dione.
| Compound Name | 2-[4-[3,6-bis(dimethylamino)acridin-10-ium-10-yl]butyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 46918482 |
| Molecular Formula | C29H31N4O2+ |
| Molecular Weight | 467.59 g/mol |
| Exact Mass | 467.24 |
| IUPAC Name | 2-[4-[3,6-bis(dimethylamino)acridin-10-ium-10-yl]butyl]isoindole-1,3-dione |
| SMILES | CN(C)c1ccc2cc3ccc(N(C)C)cc3[n+](CCCCN3C(=O)c4ccccc4C3=O)c2c1 |
| InChI | InChI=1S/C29H31N4O2/c1-30(2)22-13-11-20-17-21-12-14-23(31(3)4)19-27(21)32(26(20)18-22)15-7-8-16-33-28(34)24-9-5-6-10-25(24)29(33)35/h5-6,9-14,17-19H,7-8,15-16H2,1-4H3/q+1 |
| InChIKey | KWWJGJIRIIRMNJ-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 47.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.59 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|