C31H45N3O3Si — CID 142608790
8-[4-[3,7-bis(dimethylamino)-5,5-dimethylbenzo[b][1]benzosilin-10-ylidene]butanoylamino]octanoic acid (PubChem CID 142608790) has the molecular formula C31H45N3O3Si and a molecular weight of 535.81 g/mol. Its IUPAC name is 8-[4-[3,7-bis(dimethylamino)-5,5-dimethylbenzo[b][1]benzosilin-10-ylidene]butanoylamino]octanoic acid.
| Compound Name | 8-[4-[3,7-bis(dimethylamino)-5,5-dimethylbenzo[b][1]benzosilin-10-ylidene]butanoylamino]octanoic acid |
|---|---|
| PubChem CID | 142608790 |
| Molecular Formula | C31H45N3O3Si |
| Molecular Weight | 535.81 g/mol |
| Exact Mass | 535.32 |
| IUPAC Name | 8-[4-[3,7-bis(dimethylamino)-5,5-dimethylbenzo[b][1]benzosilin-10-ylidene]butanoylamino]octanoic acid |
| SMILES | CN(C)c1ccc2c(c1)[Si](C)(C)c1cc(N(C)C)ccc1C2=CCCC(=O)NCCCCCCCC(=O)O |
| InChI | InChI=1S/C31H45N3O3Si/c1-33(2)23-16-18-26-25(13-12-14-30(35)32-20-11-9-7-8-10-15-31(36)37)27-19-17-24(34(3)4)22-29(27)38(5,6)28(26)21-23/h13,16-19,21-22H,7-12,14-15,20H2,1-6H3,(H,32,35)(H,36,37) |
| InChIKey | YJQUMEOKAQRMLU-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 72.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.81 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|