C15H11Cl6N3O4 — CID 159011649
3-[4-[4,6-bis(trichloromethyl)-1,3,5-triazin-2-yl]-2-methoxyphenoxy]propanoic acid (PubChem CID 159011649) has the molecular formula C15H11Cl6N3O4 and a molecular weight of 509.99 g/mol. Its IUPAC name is 3-[4-[4,6-bis(trichloromethyl)-1,3,5-triazin-2-yl]-2-methoxyphenoxy]propanoic acid.
| Compound Name | 3-[4-[4,6-bis(trichloromethyl)-1,3,5-triazin-2-yl]-2-methoxyphenoxy]propanoic acid |
|---|---|
| PubChem CID | 159011649 |
| Molecular Formula | C15H11Cl6N3O4 |
| Molecular Weight | 509.99 g/mol |
| Exact Mass | 506.89 |
| IUPAC Name | 3-[4-[4,6-bis(trichloromethyl)-1,3,5-triazin-2-yl]-2-methoxyphenoxy]propanoic acid |
| SMILES | COc1cc(-c2nc(C(Cl)(Cl)Cl)nc(C(Cl)(Cl)Cl)n2)ccc1OCCC(=O)O |
| InChI | InChI=1S/C15H11Cl6N3O4/c1-27-9-6-7(2-3-8(9)28-5-4-10(25)26)11-22-12(14(16,17)18)24-13(23-11)15(19,20)21/h2-3,6H,4-5H2,1H3,(H,25,26) |
| InChIKey | JSOITUHGAYXXFG-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 94.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.99 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|