C18H22Cl3N5O3 — CID 85472663
2-[4-[4-(3,4-dimethoxyphenyl)-6-(trichloromethyl)-1,3,5-triazin-2-yl]piperazin-1-yl]ethanol (PubChem CID 85472663) has the molecular formula C18H22Cl3N5O3 and a molecular weight of 462.77 g/mol. Its IUPAC name is 2-[4-[4-(3,4-dimethoxyphenyl)-6-(trichloromethyl)-1,3,5-triazin-2-yl]piperazin-1-yl]ethanol.
| Compound Name | 2-[4-[4-(3,4-dimethoxyphenyl)-6-(trichloromethyl)-1,3,5-triazin-2-yl]piperazin-1-yl]ethanol |
|---|---|
| PubChem CID | 85472663 |
| Molecular Formula | C18H22Cl3N5O3 |
| Molecular Weight | 462.77 g/mol |
| Exact Mass | 461.08 |
| IUPAC Name | 2-[4-[4-(3,4-dimethoxyphenyl)-6-(trichloromethyl)-1,3,5-triazin-2-yl]piperazin-1-yl]ethanol |
| SMILES | COc1ccc(-c2nc(N3CCN(CCO)CC3)nc(C(Cl)(Cl)Cl)n2)cc1OC |
| InChI | InChI=1S/C18H22Cl3N5O3/c1-28-13-4-3-12(11-14(13)29-2)15-22-16(18(19,20)21)24-17(23-15)26-7-5-25(6-8-26)9-10-27/h3-4,11,27H,5-10H2,1-2H3 |
| InChIKey | DQEXTIVWOMJJIO-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 83.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.77 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|