C16H18Cl3N5O — CID 118250581
1-[4-(3-methoxyphenyl)-6-(trichloromethyl)-1,3,5-triazin-2-yl]piperidin-4-amine (PubChem CID 118250581) has the molecular formula C16H18Cl3N5O and a molecular weight of 402.71 g/mol. Its IUPAC name is 1-[4-(3-methoxyphenyl)-6-(trichloromethyl)-1,3,5-triazin-2-yl]piperidin-4-amine.
| Compound Name | 1-[4-(3-methoxyphenyl)-6-(trichloromethyl)-1,3,5-triazin-2-yl]piperidin-4-amine |
|---|---|
| PubChem CID | 118250581 |
| Molecular Formula | C16H18Cl3N5O |
| Molecular Weight | 402.71 g/mol |
| Exact Mass | 401.06 |
| IUPAC Name | 1-[4-(3-methoxyphenyl)-6-(trichloromethyl)-1,3,5-triazin-2-yl]piperidin-4-amine |
| SMILES | COc1cccc(-c2nc(N3CCC(N)CC3)nc(C(Cl)(Cl)Cl)n2)c1 |
| InChI | InChI=1S/C16H18Cl3N5O/c1-25-12-4-2-3-10(9-12)13-21-14(16(17,18)19)23-15(22-13)24-7-5-11(20)6-8-24/h2-4,9,11H,5-8,20H2,1H3 |
| InChIKey | HATHXVIMWINTLN-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 77.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.71 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|