C17H14Cl3N5O — CID 118250410
4-(3-methoxyphenyl)-N-(pyridin-3-ylmethyl)-6-(trichloromethyl)-1,3,5-triazin-2-amine (PubChem CID 118250410) has the molecular formula C17H14Cl3N5O and a molecular weight of 410.69 g/mol. Its IUPAC name is 4-(3-methoxyphenyl)-N-(pyridin-3-ylmethyl)-6-(trichloromethyl)-1,3,5-triazin-2-amine.
| Compound Name | 4-(3-methoxyphenyl)-N-(pyridin-3-ylmethyl)-6-(trichloromethyl)-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 118250410 |
| Molecular Formula | C17H14Cl3N5O |
| Molecular Weight | 410.69 g/mol |
| Exact Mass | 409.03 |
| IUPAC Name | 4-(3-methoxyphenyl)-N-(pyridin-3-ylmethyl)-6-(trichloromethyl)-1,3,5-triazin-2-amine |
| SMILES | COc1cccc(-c2nc(NCc3cccnc3)nc(C(Cl)(Cl)Cl)n2)c1 |
| InChI | InChI=1S/C17H14Cl3N5O/c1-26-13-6-2-5-12(8-13)14-23-15(17(18,19)20)25-16(24-14)22-10-11-4-3-7-21-9-11/h2-9H,10H2,1H3,(H,22,23,24,25) |
| InChIKey | TXPVTKLDYFXQJD-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 72.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.69 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|