C18H20N4O2 — CID 110924557
2-[3-(3-methoxyphenyl)-5-(pyridin-3-ylmethylamino)pyrazol-1-yl]ethanol (PubChem CID 110924557) has the molecular formula C18H20N4O2 and a molecular weight of 324.38 g/mol. Its IUPAC name is 2-[3-(3-methoxyphenyl)-5-(pyridin-3-ylmethylamino)pyrazol-1-yl]ethanol.
| Compound Name | 2-[3-(3-methoxyphenyl)-5-(pyridin-3-ylmethylamino)pyrazol-1-yl]ethanol |
|---|---|
| PubChem CID | 110924557 |
| Molecular Formula | C18H20N4O2 |
| Molecular Weight | 324.38 g/mol |
| Exact Mass | 324.16 |
| IUPAC Name | 2-[3-(3-methoxyphenyl)-5-(pyridin-3-ylmethylamino)pyrazol-1-yl]ethanol |
| SMILES | COc1cccc(-c2cc(NCc3cccnc3)n(CCO)n2)c1 |
| InChI | InChI=1S/C18H20N4O2/c1-24-16-6-2-5-15(10-16)17-11-18(22(21-17)8-9-23)20-13-14-4-3-7-19-12-14/h2-7,10-12,20,23H,8-9,13H2,1H3 |
| InChIKey | CZKNZMXWCNLPGV-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 72.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.38 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |