C11H8Cl3N3O2 — CID 135704022
4-(3-methoxyphenyl)-6-(trichloromethyl)-1H-1,3,5-triazin-2-one (PubChem CID 135704022) has the molecular formula C11H8Cl3N3O2 and a molecular weight of 320.56 g/mol. Its IUPAC name is 4-(3-methoxyphenyl)-6-(trichloromethyl)-1H-1,3,5-triazin-2-one.
| Compound Name | 4-(3-methoxyphenyl)-6-(trichloromethyl)-1H-1,3,5-triazin-2-one |
|---|---|
| PubChem CID | 135704022 |
| Molecular Formula | C11H8Cl3N3O2 |
| Molecular Weight | 320.56 g/mol |
| Exact Mass | 318.97 |
| IUPAC Name | 4-(3-methoxyphenyl)-6-(trichloromethyl)-1H-1,3,5-triazin-2-one |
| SMILES | COc1cccc(-c2nc(C(Cl)(Cl)Cl)[nH]c(=O)n2)c1 |
| InChI | InChI=1S/C11H8Cl3N3O2/c1-19-7-4-2-3-6(5-7)8-15-9(11(12,13)14)17-10(18)16-8/h2-5H,1H3,(H,15,16,17,18) |
| InChIKey | ZAHQQNZWWAHDFC-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.56 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|