About 4-(3-methoxyphenyl)-1,5-dihydroindeno[1,2-d]pyrimidin-2-one
4-(3-methoxyphenyl)-1,5-dihydroindeno[1,2-d]pyrimidin-2-one (PubChem CID 44606008) has the molecular formula C18H14N2O2
and a molecular weight of 290.32 g/mol. Its IUPAC name is 4-(3-methoxyphenyl)-1,5-dihydroindeno[1,2-d]pyrimidin-2-one.
Molecular Properties
| Compound Name | 4-(3-methoxyphenyl)-1,5-dihydroindeno[1,2-d]pyrimidin-2-one |
| PubChem CID | 44606008 |
| Molecular Formula | C18H14N2O2 |
| Molecular Weight | 290.32 g/mol |
| Exact Mass | 290.11 |
| IUPAC Name | 4-(3-methoxyphenyl)-1,5-dihydroindeno[1,2-d]pyrimidin-2-one |
| SMILES | COc1cccc(-c2nc(=O)[nH]c3c2Cc2ccccc2-3)c1 |
| InChI | InChI=1S/C18H14N2O2/c1-22-13-7-4-6-12(9-13)16-15-10-11-5-2-3-8-14(11)17(15)20-18(21)19-16/h2-9H,10H2,1H3,(H,19,20,21) |
| InChIKey | HCSVKCOHFRFGQH-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 54.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 290.32 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-(3-methoxyphenyl)-1,5-dihydroindeno[1,2-d]pyrimidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(3-methoxyphenyl)-1,5-dihydroindeno[1,2-d]pyrimidin-2-one?
The IUPAC name of 4-(3-methoxyphenyl)-1,5-dihydroindeno[1,2-d]pyrimidin-2-one (CID 44606008) is 4-(3-methoxyphenyl)-1,5-dihydroindeno[1,2-d]pyrimidin-2-one.
What is the SMILES notation for 4-(3-methoxyphenyl)-1,5-dihydroindeno[1,2-d]pyrimidin-2-one?
The canonical SMILES for 4-(3-methoxyphenyl)-1,5-dihydroindeno[1,2-d]pyrimidin-2-one is COc1cccc(-c2nc(=O)[nH]c3c2Cc2ccccc2-3)c1.
What is the InChIKey of 4-(3-methoxyphenyl)-1,5-dihydroindeno[1,2-d]pyrimidin-2-one?
The InChIKey is HCSVKCOHFRFGQH-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H14N2O2/c1-22-13-7-4-6-12(9-13)16-15-10-11-5-2-3-8-14(11)17(15)20-18(21)19-16/h2-9H,10H2,1H3,(H,19,20,21).
What are the key properties of 4-(3-methoxyphenyl)-1,5-dihydroindeno[1,2-d]pyrimidin-2-one?
4-(3-methoxyphenyl)-1,5-dihydroindeno[1,2-d]pyrimidin-2-one has a molecular weight of 290.32 g/mol, XLogP of 3.02, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(3-methoxyphenyl)-1,5-dihydroindeno[1,2-d]pyrimidin-2-one is sourced from PubChem (CID 44606008), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).