About ethyl 2-[3-(1,4-dihydroindeno[2,1-d]pyrazol-3-yl)phenoxy]acetate
ethyl 2-[3-(1,4-dihydroindeno[2,1-d]pyrazol-3-yl)phenoxy]acetate (PubChem CID 18415841) has the molecular formula C20H18N2O3
and a molecular weight of 334.38 g/mol. Its IUPAC name is ethyl 2-[3-(1,4-dihydroindeno[2,1-d]pyrazol-3-yl)phenoxy]acetate.
Molecular Properties
| Compound Name | ethyl 2-[3-(1,4-dihydroindeno[2,1-d]pyrazol-3-yl)phenoxy]acetate |
| PubChem CID | 18415841 |
| Molecular Formula | C20H18N2O3 |
| Molecular Weight | 334.38 g/mol |
| Exact Mass | 334.13 |
| IUPAC Name | ethyl 2-[3-(1,4-dihydroindeno[2,1-d]pyrazol-3-yl)phenoxy]acetate |
| SMILES | CCOC(=O)COc1cccc(-c2n[nH]c3c2Cc2ccccc2-3)c1 |
| InChI | InChI=1S/C20H18N2O3/c1-2-24-18(23)12-25-15-8-5-7-14(10-15)19-17-11-13-6-3-4-9-16(13)20(17)22-21-19/h3-10H,2,11-12H2,1H3,(H,21,22) |
| InChIKey | DOMDPVJKTBOZGZ-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 64.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 334.38 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze ethyl 2-[3-(1,4-dihydroindeno[2,1-d]pyrazol-3-yl)phenoxy]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-[3-(1,4-dihydroindeno[2,1-d]pyrazol-3-yl)phenoxy]acetate?
The IUPAC name of ethyl 2-[3-(1,4-dihydroindeno[2,1-d]pyrazol-3-yl)phenoxy]acetate (CID 18415841) is ethyl 2-[3-(1,4-dihydroindeno[2,1-d]pyrazol-3-yl)phenoxy]acetate.
What is the SMILES notation for ethyl 2-[3-(1,4-dihydroindeno[2,1-d]pyrazol-3-yl)phenoxy]acetate?
The canonical SMILES for ethyl 2-[3-(1,4-dihydroindeno[2,1-d]pyrazol-3-yl)phenoxy]acetate is CCOC(=O)COc1cccc(-c2n[nH]c3c2Cc2ccccc2-3)c1.
What is the InChIKey of ethyl 2-[3-(1,4-dihydroindeno[2,1-d]pyrazol-3-yl)phenoxy]acetate?
The InChIKey is DOMDPVJKTBOZGZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H18N2O3/c1-2-24-18(23)12-25-15-8-5-7-14(10-15)19-17-11-13-6-3-4-9-16(13)20(17)22-21-19/h3-10H,2,11-12H2,1H3,(H,21,22).
What are the key properties of ethyl 2-[3-(1,4-dihydroindeno[2,1-d]pyrazol-3-yl)phenoxy]acetate?
ethyl 2-[3-(1,4-dihydroindeno[2,1-d]pyrazol-3-yl)phenoxy]acetate has a molecular weight of 334.38 g/mol, XLogP of 3.59, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-[3-(1,4-dihydroindeno[2,1-d]pyrazol-3-yl)phenoxy]acetate is sourced from PubChem (CID 18415841), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).