C9H8N2O2S — CID 22378610
5-(3-methoxyphenyl)-1,2,4-thiadiazol-3-one (PubChem CID 22378610) has the molecular formula C9H8N2O2S and a molecular weight of 208.24 g/mol. Its IUPAC name is 5-(3-methoxyphenyl)-1,2,4-thiadiazol-3-one.
| Compound Name | 5-(3-methoxyphenyl)-1,2,4-thiadiazol-3-one |
|---|---|
| PubChem CID | 22378610 |
| Molecular Formula | C9H8N2O2S |
| Molecular Weight | 208.24 g/mol |
| Exact Mass | 208.03 |
| IUPAC Name | 5-(3-methoxyphenyl)-1,2,4-thiadiazol-3-one |
| SMILES | COc1cccc(-c2nc(=O)[nH]s2)c1 |
| InChI | InChI=1S/C9H8N2O2S/c1-13-7-4-2-3-6(5-7)8-10-9(12)11-14-8/h2-5H,1H3,(H,11,12) |
| InChIKey | HYODRCACTQQXFG-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 54.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.24 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |