C19H15ClO6 — CID 154647322
3-[5-(8-chloro-4-oxochromen-2-yl)-2-methoxyphenoxy]propanoic acid (PubChem CID 154647322) has the molecular formula C19H15ClO6 and a molecular weight of 374.78 g/mol. Its IUPAC name is 3-[5-(8-chloro-4-oxochromen-2-yl)-2-methoxyphenoxy]propanoic acid.
| Compound Name | 3-[5-(8-chloro-4-oxochromen-2-yl)-2-methoxyphenoxy]propanoic acid |
|---|---|
| PubChem CID | 154647322 |
| Molecular Formula | C19H15ClO6 |
| Molecular Weight | 374.78 g/mol |
| Exact Mass | 374.06 |
| IUPAC Name | 3-[5-(8-chloro-4-oxochromen-2-yl)-2-methoxyphenoxy]propanoic acid |
| SMILES | COc1ccc(-c2cc(=O)c3cccc(Cl)c3o2)cc1OCCC(=O)O |
| InChI | InChI=1S/C19H15ClO6/c1-24-15-6-5-11(9-17(15)25-8-7-18(22)23)16-10-14(21)12-3-2-4-13(20)19(12)26-16/h2-6,9-10H,7-8H2,1H3,(H,22,23) |
| InChIKey | MPCPYWZDNYVYKX-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 85.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.78 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |