C24H22BrClO7 — CID 165062483
ethyl 6-[2-bromo-5-(8-chloro-4-oxochromen-2-yl)-4-methoxyphenoxy]-2-oxohexanoate (PubChem CID 165062483) has the molecular formula C24H22BrClO7 and a molecular weight of 537.79 g/mol. Its IUPAC name is ethyl 6-[2-bromo-5-(8-chloro-4-oxochromen-2-yl)-4-methoxyphenoxy]-2-oxohexanoate.
| Compound Name | ethyl 6-[2-bromo-5-(8-chloro-4-oxochromen-2-yl)-4-methoxyphenoxy]-2-oxohexanoate |
|---|---|
| PubChem CID | 165062483 |
| Molecular Formula | C24H22BrClO7 |
| Molecular Weight | 537.79 g/mol |
| Exact Mass | 536.02 |
| IUPAC Name | ethyl 6-[2-bromo-5-(8-chloro-4-oxochromen-2-yl)-4-methoxyphenoxy]-2-oxohexanoate |
| SMILES | CCOC(=O)C(=O)CCCCOc1cc(-c2cc(=O)c3cccc(Cl)c3o2)c(OC)cc1Br |
| InChI | InChI=1S/C24H22BrClO7/c1-3-31-24(29)18(27)9-4-5-10-32-22-11-15(20(30-2)12-16(22)25)21-13-19(28)14-7-6-8-17(26)23(14)33-21/h6-8,11-13H,3-5,9-10H2,1-2H3 |
| InChIKey | RKTSLQGQMZCFHA-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 92.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.79 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|