C18H15BrClNO3 — CID 151649814
2-[2-(3-aminopropoxy)-4-bromophenyl]-8-chlorochromen-4-one (PubChem CID 151649814) has the molecular formula C18H15BrClNO3 and a molecular weight of 408.68 g/mol. Its IUPAC name is 2-[2-(3-aminopropoxy)-4-bromophenyl]-8-chlorochromen-4-one.
| Compound Name | 2-[2-(3-aminopropoxy)-4-bromophenyl]-8-chlorochromen-4-one |
|---|---|
| PubChem CID | 151649814 |
| Molecular Formula | C18H15BrClNO3 |
| Molecular Weight | 408.68 g/mol |
| Exact Mass | 406.99 |
| IUPAC Name | 2-[2-(3-aminopropoxy)-4-bromophenyl]-8-chlorochromen-4-one |
| SMILES | NCCCOc1cc(Br)ccc1-c1cc(=O)c2cccc(Cl)c2o1 |
| InChI | InChI=1S/C18H15BrClNO3/c19-11-5-6-13(16(9-11)23-8-2-7-21)17-10-15(22)12-3-1-4-14(20)18(12)24-17/h1,3-6,9-10H,2,7-8,21H2 |
| InChIKey | QUGXLSSXMZFFAQ-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 65.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.68 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|