C18H12BrClO4 — CID 175132462
3-[5-bromo-2-(8-chloro-4-oxochromen-2-yl)phenoxy]propanal (PubChem CID 175132462) has the molecular formula C18H12BrClO4 and a molecular weight of 407.65 g/mol. Its IUPAC name is 3-[5-bromo-2-(8-chloro-4-oxochromen-2-yl)phenoxy]propanal.
| Compound Name | 3-[5-bromo-2-(8-chloro-4-oxochromen-2-yl)phenoxy]propanal |
|---|---|
| PubChem CID | 175132462 |
| Molecular Formula | C18H12BrClO4 |
| Molecular Weight | 407.65 g/mol |
| Exact Mass | 405.96 |
| IUPAC Name | 3-[5-bromo-2-(8-chloro-4-oxochromen-2-yl)phenoxy]propanal |
| SMILES | O=CCCOc1cc(Br)ccc1-c1cc(=O)c2cccc(Cl)c2o1 |
| InChI | InChI=1S/C18H12BrClO4/c19-11-5-6-13(16(9-11)23-8-2-7-21)17-10-15(22)12-3-1-4-14(20)18(12)24-17/h1,3-7,9-10H,2,8H2 |
| InChIKey | LIVBQAZUQLCYSU-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 56.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.65 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|