C23H23BrClNO4 — CID 175908638
2-[4-bromo-2-[3-(oxan-4-ylamino)propoxy]phenyl]-8-chlorochromen-4-one (PubChem CID 175908638) has the molecular formula C23H23BrClNO4 and a molecular weight of 492.80 g/mol. Its IUPAC name is 2-[4-bromo-2-[3-(oxan-4-ylamino)propoxy]phenyl]-8-chlorochromen-4-one.
| Compound Name | 2-[4-bromo-2-[3-(oxan-4-ylamino)propoxy]phenyl]-8-chlorochromen-4-one |
|---|---|
| PubChem CID | 175908638 |
| Molecular Formula | C23H23BrClNO4 |
| Molecular Weight | 492.80 g/mol |
| Exact Mass | 491.05 |
| IUPAC Name | 2-[4-bromo-2-[3-(oxan-4-ylamino)propoxy]phenyl]-8-chlorochromen-4-one |
| SMILES | O=c1cc(-c2ccc(Br)cc2OCCCNC2CCOCC2)oc2c(Cl)cccc12 |
| InChI | InChI=1S/C23H23BrClNO4/c24-15-5-6-18(22-14-20(27)17-3-1-4-19(25)23(17)30-22)21(13-15)29-10-2-9-26-16-7-11-28-12-8-16/h1,3-6,13-14,16,26H,2,7-12H2 |
| InChIKey | MHASKAWSXUUGPD-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 60.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.80 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|