C22H18ClF3O5S — CID 165015800
8-chloro-2-[2-(3-cyclopropylsulfonylpropoxy)-4-(trifluoromethyl)phenyl]chromen-4-one (PubChem CID 165015800) has the molecular formula C22H18ClF3O5S and a molecular weight of 486.90 g/mol. Its IUPAC name is 8-chloro-2-[2-(3-cyclopropylsulfonylpropoxy)-4-(trifluoromethyl)phenyl]chromen-4-one.
| Compound Name | 8-chloro-2-[2-(3-cyclopropylsulfonylpropoxy)-4-(trifluoromethyl)phenyl]chromen-4-one |
|---|---|
| PubChem CID | 165015800 |
| Molecular Formula | C22H18ClF3O5S |
| Molecular Weight | 486.90 g/mol |
| Exact Mass | 486.05 |
| IUPAC Name | 8-chloro-2-[2-(3-cyclopropylsulfonylpropoxy)-4-(trifluoromethyl)phenyl]chromen-4-one |
| SMILES | O=c1cc(-c2ccc(C(F)(F)F)cc2OCCCS(=O)(=O)C2CC2)oc2c(Cl)cccc12 |
| InChI | InChI=1S/C22H18ClF3O5S/c23-17-4-1-3-15-18(27)12-20(31-21(15)17)16-8-5-13(22(24,25)26)11-19(16)30-9-2-10-32(28,29)14-6-7-14/h1,3-5,8,11-12,14H,2,6-7,9-10H2 |
| InChIKey | KJXVEHRNVQOXOP-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 73.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.90 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|