C23H19ClF3NO7S — CID 146460243
2-[2-[2-(8-chloro-4-oxochromen-2-yl)-5-(trifluoromethyl)phenoxy]ethoxy]-N-cyclopropylsulfonylacetamide (PubChem CID 146460243) has the molecular formula C23H19ClF3NO7S and a molecular weight of 545.92 g/mol. Its IUPAC name is 2-[2-[2-(8-chloro-4-oxochromen-2-yl)-5-(trifluoromethyl)phenoxy]ethoxy]-N-cyclopropylsulfonylacetamide.
| Compound Name | 2-[2-[2-(8-chloro-4-oxochromen-2-yl)-5-(trifluoromethyl)phenoxy]ethoxy]-N-cyclopropylsulfonylacetamide |
|---|---|
| PubChem CID | 146460243 |
| Molecular Formula | C23H19ClF3NO7S |
| Molecular Weight | 545.92 g/mol |
| Exact Mass | 545.05 |
| IUPAC Name | 2-[2-[2-(8-chloro-4-oxochromen-2-yl)-5-(trifluoromethyl)phenoxy]ethoxy]-N-cyclopropylsulfonylacetamide |
| SMILES | O=C(COCCOc1cc(C(F)(F)F)ccc1-c1cc(=O)c2cccc(Cl)c2o1)NS(=O)(=O)C1CC1 |
| InChI | InChI=1S/C23H19ClF3NO7S/c24-17-3-1-2-15-18(29)11-20(35-22(15)17)16-7-4-13(23(25,26)27)10-19(16)34-9-8-33-12-21(30)28-36(31,32)14-5-6-14/h1-4,7,10-11,14H,5-6,8-9,12H2,(H,28,30) |
| InChIKey | VDEADZWIJZPQIH-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 111.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.92 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|