C20H14ClF3O6 — CID 146460295
4-[2-(8-chloro-5-hydroxy-4-oxochromen-2-yl)-5-(trifluoromethyl)phenoxy]butanoic acid (PubChem CID 146460295) has the molecular formula C20H14ClF3O6 and a molecular weight of 442.77 g/mol. Its IUPAC name is 4-[2-(8-chloro-5-hydroxy-4-oxochromen-2-yl)-5-(trifluoromethyl)phenoxy]butanoic acid.
| Compound Name | 4-[2-(8-chloro-5-hydroxy-4-oxochromen-2-yl)-5-(trifluoromethyl)phenoxy]butanoic acid |
|---|---|
| PubChem CID | 146460295 |
| Molecular Formula | C20H14ClF3O6 |
| Molecular Weight | 442.77 g/mol |
| Exact Mass | 442.04 |
| IUPAC Name | 4-[2-(8-chloro-5-hydroxy-4-oxochromen-2-yl)-5-(trifluoromethyl)phenoxy]butanoic acid |
| SMILES | O=C(O)CCCOc1cc(C(F)(F)F)ccc1-c1cc(=O)c2c(O)ccc(Cl)c2o1 |
| InChI | InChI=1S/C20H14ClF3O6/c21-12-5-6-13(25)18-14(26)9-16(30-19(12)18)11-4-3-10(20(22,23)24)8-15(11)29-7-1-2-17(27)28/h3-6,8-9,25H,1-2,7H2,(H,27,28) |
| InChIKey | MMUPQAZAWYNAEP-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 96.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.77 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|