C21H16ClF3O6 — CID 146460587
4-[2-(8-chloro-5-hydroxy-4-oxochromen-2-yl)-5-(2,2,2-trifluoroethyl)phenoxy]butanoic acid (PubChem CID 146460587) has the molecular formula C21H16ClF3O6 and a molecular weight of 456.80 g/mol. Its IUPAC name is 4-[2-(8-chloro-5-hydroxy-4-oxochromen-2-yl)-5-(2,2,2-trifluoroethyl)phenoxy]butanoic acid.
| Compound Name | 4-[2-(8-chloro-5-hydroxy-4-oxochromen-2-yl)-5-(2,2,2-trifluoroethyl)phenoxy]butanoic acid |
|---|---|
| PubChem CID | 146460587 |
| Molecular Formula | C21H16ClF3O6 |
| Molecular Weight | 456.80 g/mol |
| Exact Mass | 456.06 |
| IUPAC Name | 4-[2-(8-chloro-5-hydroxy-4-oxochromen-2-yl)-5-(2,2,2-trifluoroethyl)phenoxy]butanoic acid |
| SMILES | O=C(O)CCCOc1cc(CC(F)(F)F)ccc1-c1cc(=O)c2c(O)ccc(Cl)c2o1 |
| InChI | InChI=1S/C21H16ClF3O6/c22-13-5-6-14(26)19-15(27)9-17(31-20(13)19)12-4-3-11(10-21(23,24)25)8-16(12)30-7-1-2-18(28)29/h3-6,8-9,26H,1-2,7,10H2,(H,28,29) |
| InChIKey | LFGRVICLYYLVFY-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 96.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.80 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|