C20H14ClF3O6 — CID 146460337
methyl 3-[2-(8-chloro-4-oxochromen-2-yl)-5-(trifluoromethyl)phenoxy]-2-hydroxypropanoate (PubChem CID 146460337) has the molecular formula C20H14ClF3O6 and a molecular weight of 442.77 g/mol. Its IUPAC name is methyl 3-[2-(8-chloro-4-oxochromen-2-yl)-5-(trifluoromethyl)phenoxy]-2-hydroxypropanoate.
| Compound Name | methyl 3-[2-(8-chloro-4-oxochromen-2-yl)-5-(trifluoromethyl)phenoxy]-2-hydroxypropanoate |
|---|---|
| PubChem CID | 146460337 |
| Molecular Formula | C20H14ClF3O6 |
| Molecular Weight | 442.77 g/mol |
| Exact Mass | 442.04 |
| IUPAC Name | methyl 3-[2-(8-chloro-4-oxochromen-2-yl)-5-(trifluoromethyl)phenoxy]-2-hydroxypropanoate |
| SMILES | COC(=O)C(O)COc1cc(C(F)(F)F)ccc1-c1cc(=O)c2cccc(Cl)c2o1 |
| InChI | InChI=1S/C20H14ClF3O6/c1-28-19(27)15(26)9-29-16-7-10(20(22,23)24)5-6-12(16)17-8-14(25)11-3-2-4-13(21)18(11)30-17/h2-8,15,26H,9H2,1H3 |
| InChIKey | GZUUUPXIJPPWCS-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 85.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.77 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |